Systematic / IUPAC Name: 3-Oxo-3-phenyl-1-(3-thienyl)propyl carbamodithioate
ID: Reference4809
Other Names: Carbamodithioic acid,3-oxo-3-phenyl-1-(3-thienyl)propyl ester
Formula: C14H13NOS3
3-Oxo-3-phenyl-1-(3-thienyl)propyl aminomethanedithioate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 65 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 5/12/2016 7:30:24 AM |
| InChI | InChI=1S/C14H13NOS3/c15-14(17)19-13(11-6-7-18-9-11)8-12(16)10-4-2-1-3-5-10/h1-7,9,13H,8H2,(H2,15,17) |
| InChI Key | PEGKBRXZOKOCGM-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=C(C=C1)C(=O)CC(C2=CSC=C2)SC(=S)N |
| CAS | 286366709 |
| Splash | |
| Other Names | Carbamodithioic acid,3-oxo-3-phenyl-1-(3-thienyl)propyl ester |