Systematic / IUPAC Name: 2,2-Dichloro-N-(2,6-diethylphenyl)acetamide
ID: Reference4812
Other Names:
N1-(2,6-Diethylphenyl)-2,2-dichloroacetamide ;
Acetamide, 2,2-dichloro-N-(2,6-diethylphenyl)-
Formula: C12H15Cl2NO
2,2-Dichloro-N-(2,6-diethylphenyl)acetamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 5/12/2016 8:10:47 AM |
| InChI | InChI=1S/C12H15Cl2NO/c1-3-8-6-5-7-9(4-2)10(8)15-12(16)11(13)14/h5-7,11H,3-4H2,1-2H3,(H,15,16) |
| InChI Key | UWSSKYADLNGQSY-UHFFFAOYSA-N |
| Canonical SMILES | CCC1=C(C(=CC=C1)CC)NC(=O)C(Cl)Cl |
| CAS | 39106122 |
| Splash | |
| Other Names |
N1-(2,6-Diethylphenyl)-2,2-dichloroacetamide ; Acetamide, 2,2-dichloro-N-(2,6-diethylphenyl)- |