Systematic / IUPAC Name: 2-Methyl-N-(4-morpholinyl)-6-(trifluoromethyl)nicotinamide
ID: Reference4813
Other Names: 3-Pyridinecarboxamide, 2-methyl-N-4-morpholinyl-6-(trifluoromethyl)-
Formula: C12H14F3N3O2
2-Methyl-N-morpholino-6-(trifluoromethyl)nicotinamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 5/12/2016 9:12:35 AM |
| InChI | InChI=1S/C12H14F3N3O2/c1-8-9(2-3-10(16-8)12(13,14)15)11(19)17-18-4-6-20-7-5-18/h2-3H,4-7H2,1H3,(H,17,19) |
| InChI Key | GWLJYQKJZDNNNN-UHFFFAOYSA-N |
| Canonical SMILES | CC1=C(C=CC(=N1)C(F)(F)F)C(=O)NN2CCOCC2 |
| CAS | |
| Splash | |
| Other Names | 3-Pyridinecarboxamide, 2-methyl-N-4-morpholinyl-6-(trifluoromethyl)- |
| PubChem | 2811172 |
| ChemSpider | 2089584 |
| ChEMBL | CHEMBL1717017 |