Systematic / IUPAC Name: (2-Amino-4,5-dimethyl-3-thienyl)(2-thienyl)methanone
ID: Reference4816
Other Names:
(2-Amino-4,5-dimethylthiophen-3-yl)(thiophen-2-yl)methanone;
Methanone, (2-amino-4,5-dimethyl-3-thienyl)-2-thienyl-
Formula: C11H11NOS2
(2-Amino-4,5-dimethyl-3-thienyl)(2-thienyl)methanone mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 5/12/2016 9:40:36 AM |
| InChI | InChI=1S/C11H11NOS2/c1-6-7(2)15-11(12)9(6)10(13)8-4-3-5-14-8/h3-5H,12H2,1-2H3 |
| InChI Key | ANFQRMBWHBVDIF-UHFFFAOYSA-N |
| Canonical SMILES | CC1=C(SC(=C1C(=O)C2=CC=CS2)N)C |
| CAS | |
| Splash | |
| Other Names |
(2-Amino-4,5-dimethylthiophen-3-yl)(thiophen-2-yl)methanone; Methanone, (2-amino-4,5-dimethyl-3-thienyl)-2-thienyl- |