Systematic / IUPAC Name: N-Cyclopropyl-3-[4-(trifluoromethyl)phenyl][1,2,4]triazolo[4,3-b]pyridazin-6-amine
ID: Reference4823
Other Names: 1,2,4-Triazolo[4,3-b]pyridazin-6-amine, N-cyclopropyl-3-[4-(trifluoromethyl)phenyl]-
Formula: C15H12F3N5
N6-Cyclopropyl-3-[4-(trifluoromethyl)phenyl][1,2,4]triazolo[4,3-b]pyridazin-6-amine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 5/12/2016 11:40:33 AM |
| InChI | InChI=1S/C15H12F3N5/c16-15(17,18)10-3-1-9(2-4-10)14-21-20-13-8-7-12(22-23(13)14)19-11-5-6-11/h1-4,7-8,11H,5-6H2,(H,19,22) |
| InChI Key | IRFDEDLBWHFGGS-UHFFFAOYSA-N |
| Canonical SMILES | C1CC1NC2=NN3C(=NN=C3C4=CC=C(C=C4)C(F)(F)F)C=C2 |
| CAS | |
| Splash | |
| Other Names | 1,2,4-Triazolo[4,3-b]pyridazin-6-amine, N-cyclopropyl-3-[4-(trifluoromethyl)phenyl]- |
| PubChem | 2727417 |
| ChEMBL | CHEMBL451964 |
| ChemSpider | 2009438 |