Systematic / IUPAC Name: 4-(4-Methoxyphenyl)-6-(trifluoromethyl)-2-pyrimidinamine
ID: Reference4824
Other Names:
4-(4-Methoxyphenyl)-6-(trifluoromethyl)pyrimidine-2-ylamine;
2-Pyrimidinamine, 4-(4-methoxyphenyl)-6-(trifluoromethyl)-
Formula: C12H10F3N3O
4-(4-Methoxyphenyl)-6-(trifluoromethyl)pyrimidin-2-amine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 5/12/2016 12:20:52 PM |
| InChI | InChI=1S/C12H10F3N3O/c1-19-8-4-2-7(3-5-8)9-6-10(12(13,14)15)18-11(16)17-9/h2-6H,1H3,(H2,16,17,18) |
| InChI Key | RAYWTBJRRQFSID-UHFFFAOYSA-N |
| Canonical SMILES | COC1=CC=C(C=C1)C2=CC(=NC(=N2)N)C(F)(F)F |
| CAS | 519056510 |
| Splash | |
| Other Names |
4-(4-Methoxyphenyl)-6-(trifluoromethyl)pyrimidine-2-ylamine; 2-Pyrimidinamine, 4-(4-methoxyphenyl)-6-(trifluoromethyl)- |
| ChemSpider | 2101538 |
| ChEMBL | CHEMBL1606931 |
| PubChem | 2823326 |