Systematic / IUPAC Name: 2-{[(E)-(2,4-Dichlorobenzylidene)amino]oxy}acetohydrazide
ID: Reference4825
Other Names: Acetic acid, 2-({[(1E)-(2,4-dichlorophenyl)methylene]amino}oxy)-, hydrazide
Formula: C9H9Cl2N3O2
2-{[(2,4-Dichlorobenzylidene)amino]oxy}ethanohydrazide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 5/12/2016 12:36:56 PM |
| InChI | InChI=1S/C9H9Cl2N3O2/c10-7-2-1-6(8(11)3-7)4-13-16-5-9(15)14-12/h1-4H,5,12H2,(H,14,15)/b13-4+ |
| InChI Key | OTCLTXZNYIQKLD-YIXHJXPBSA-N |
| Canonical SMILES | C1=CC(=C(C=C1Cl)Cl)C=NOCC(=O)NN |
| CAS | |
| Splash | |
| Other Names | Acetic acid, 2-({[(1E)-(2,4-dichlorophenyl)methylene]amino}oxy)-, hydrazide |