Systematic / IUPAC Name: 6-(3,4-Dichlorophenyl)-5,6-dihydrobenzimidazo[1,2-c]quinazoline
ID: Reference4839
Other Names:
9-(3,4-dichlorophenyl)-8,10,17-triazatetracyclo[8.7.0.0²,7.0¹¹,¹6]heptadeca-1(17),2,4,6,11,13,15-heptaene ;
Benzimidazo[1,2-c]quinazoline, 6-(3,4-dichlorophenyl)-5,6-dihydro-
Formula: C20H13Cl2N3
6-(3,4-Dichlorophenyl)-5,6-dihydrobenzo[4,5]imidazo[1,2-c]quinazoline mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 5/13/2016 5:51:19 AM |
| InChI | InChI=1S/C20H13Cl2N3/c21-14-10-9-12(11-15(14)22)19-23-16-6-2-1-5-13(16)20-24-17-7-3-4-8-18(17)25(19)20/h1-11,19,23H |
| InChI Key | GAKHZHDADCDJAB-UHFFFAOYSA-N |
| Canonical SMILES | c1ccc2c(c1)-c3nc4ccccc4n3C(N2)c5ccc(c(c5)Cl)Cl |
| CAS | |
| Splash | |
| Other Names |
9-(3,4-dichlorophenyl)-8,10,17-triazatetracyclo[8.7.0.0²,7.0¹¹,¹6]heptadeca-1(17),2,4,6,11,13,15-heptaene ; Benzimidazo[1,2-c]quinazoline, 6-(3,4-dichlorophenyl)-5,6-dihydro- |
| ChemSpider | 18006709 |