Systematic / IUPAC Name: 4-(2-Acetamidoethyl)phenyl acetate
ID: Reference4840
Other Names:
N,O-Diacetyltyramine;
O4N-Diacetyltyramine ;
Acetamide, N-(p-hydroxyphenethyl), acetate ;
Acetamide, N-{2-[4-(acetyloxy)phenyl]ethyl}-
Formula: C12H15NO3
4-[2-(Acetylamino)ethyl]phenyl acetate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 5/13/2016 6:30:37 AM |
| InChI | InChI=1S/C12H15NO3/c1-9(14)13-8-7-11-3-5-12(6-4-11)16-10(2)15/h3-6H,7-8H2,1-2H3,(H,13,14) |
| InChI Key | RNDRBPVTMKQIBA-UHFFFAOYSA-N |
| Canonical SMILES | CC(=O)NCCC1=CC=C(C=C1)OC(=O)C |
| CAS | |
| Splash | |
| Other Names |
N,O-Diacetyltyramine; O4N-Diacetyltyramine ; Acetamide, N-(p-hydroxyphenethyl), acetate ; Acetamide, N-{2-[4-(acetyloxy)phenyl]ethyl}- |