Systematic / IUPAC Name: 1-Ethyl-6,7-dimethoxy-3(2H)-isoquinolinone
ID: Reference4843
Other Names: 3(2H)-Isoquinolinone, 1-ethyl-6,7-dimethoxy-
Formula: C13H15NO3
1-Ethyl-6,7-dimethoxyisoquinolin-3-ol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 5/13/2016 8:08:00 AM |
| InChI | InChI=1S/C13H15NO3/c1-4-10-9-7-12(17-3)11(16-2)5-8(9)6-13(15)14-10/h5-7H,4H2,1-3H3,(H,14,15) |
| InChI Key | DCVWACZNVRBNJN-UHFFFAOYSA-N |
| Canonical SMILES | CCC1=C2C=C(C(=CC2=CC(=O)N1)OC)OC |
| CAS | |
| Splash | |
| Other Names | 3(2H)-Isoquinolinone, 1-ethyl-6,7-dimethoxy- |