Systematic / IUPAC Name: N-(1,3-Benzothiazol-2-yl)-N-(3-chlorophenyl)-4-nitrobenzamide
ID: Reference4849
Other Names: Benzamide, N-2-benzothiazolyl-N-(3-chlorophenyl)-4-nitro-
Formula: C20H12ClN3O3S
N1-(1,3-Benzothiazol-2-yl)-N1-(3-chlorophenyl)-4-nitrobenzamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 5/13/2016 10:00:54 AM |
| InChI | InChI=1S/C20H12ClN3O3S/c21-14-4-3-5-16(12-14)23(20-22-17-6-1-2-7-18(17)28-20)19(25)13-8-10-15(11-9-13)24(26)27/h1-12H |
| InChI Key | SQGJJGGHSVIPPU-UHFFFAOYSA-N |
| Canonical SMILES | |
| CAS | |
| Splash | |
| Other Names | Benzamide, N-2-benzothiazolyl-N-(3-chlorophenyl)-4-nitro- |