Systematic / IUPAC Name: [1-(2-{[3-(Methylsulfanyl)phenyl]amino}-2-oxoethyl)cyclopentyl]acetic acid
ID: Reference4858
Other Names: Cyclopentaneacetic acid, 1-(2-{[3-(methylthio)phenyl]amino}-2-oxoethyl)-
Formula: C16H21NO3S
2-(1-{2-[3-(Methylthio)anilino]-2-oxoethyl}cyclopentyl)acetic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 5/13/2016 12:28:37 PM |
| InChI | InChI=1S/C16H21NO3S/c1-21-13-6-4-5-12(9-13)17-14(18)10-16(11-15(19)20)7-2-3-8-16/h4-6,9H,2-3,7-8,10-11H2,1H3,(H,17,18)(H,19,20) |
| InChI Key | NZGQMQPXRZLALG-UHFFFAOYSA-N |
| Canonical SMILES | CSC1=CC=CC(=C1)NC(=O)CC2(CCCC2)CC(=O)O |
| CAS | |
| Splash | |
| Other Names | Cyclopentaneacetic acid, 1-(2-{[3-(methylthio)phenyl]amino}-2-oxoethyl)- |