Systematic / IUPAC Name: Methionine
ID: Reference486
Other Names:
α-Amino-Υ-methylmercaptobutyric acid;
2-Amino-4-(methylthio)butanoic acid;
2-Amino-4-(methylsulfanyl)butanoic acid;
Butyric acid, 2-amino-4-(methylthio)-;
Υ-Methylthio-α-aminobutyric acid
; more
Formula: C5H11NO2S
Class: Endogenous Metabolites
Methionine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite |
| No. of Spectral Trees | 1 |
| No. of Spectra | 107 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/16/2016 10:35:41 AM |
| InChI | InChI=1S/C5H11NO2S/c1-9-3-2-4(6)5(7)8/h4H,2-3,6H2,1H3,(H,7,8) |
| InChI Key | FFEARJCKVFRZRR-UHFFFAOYSA-N |
| Canonical SMILES | CSCCC(C(=O)O)N |
| CAS | 59518 |
| Splash | |
| Other Names |
α-Amino-Υ-methylmercaptobutyric acid; 2-Amino-4-(methylthio)butanoic acid; 2-Amino-4-(methylsulfanyl)butanoic acid; Butyric acid, 2-amino-4-(methylthio)-; Υ-Methylthio-α-aminobutyric acid; Acimetion; Banthionine; Cynaron; Lobamine; Meonine; Mertionin; Metione; Urimeth; Dyprin; Neston; Pedameth; Met |
| PubChem | 876; 5255805 |
| ChemSpider | 853 |
| ChEMBL | CHEMBL274119 |
| KEGG | C01733; D04983 |
| ChEBI | CHEBI:16811; CHEBI:64558 |
| Wikipedia | Methionine |
| ChemIDPlus | 000059518; 000348674; 007005187 |