Systematic / IUPAC Name: N-Phenyl-N-(4-piperidinyl)acetamide
ID: Reference4872
Other Names:
N-Phenyl-N-(piperidin-4-yl)acetamide;
N-Phenyl-N-4-piperidinylacetamide;
Acetamide, N-phenyl-N-4-piperidinyl-
Formula: C13H18N2O
Class: Drugs of Abuse/Illegal Drugs Sports Doping Drugs
Acetyl norfentanyl mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite; Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 735 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | ESI; NSI |
| Analyzers | IT; FT |
| Last Modification | 5/17/2016 11:40:04 AM |
| InChI | InChI=1S/C13H18N2O/c1-11(16)15(12-5-3-2-4-6-12)13-7-9-14-10-8-13/h2-6,13-14H,7-10H2,1H3 |
| InChI Key | CYTIQZKDSHKYGB-UHFFFAOYSA-N |
| Canonical SMILES | CC(=O)N(C1CCNCC1)C2=CC=CC=C2 |
| CAS | |
| Splash | |
| Other Names |
N-Phenyl-N-(piperidin-4-yl)acetamide; N-Phenyl-N-4-piperidinylacetamide; Acetamide, N-phenyl-N-4-piperidinyl- |
| PubChem | 74156 |
| ChEMBL | CHEMBL2137667 |
| ChemSpider | 66767 |
| ChemIDPlus | 001607687 |