Systematic / IUPAC Name: N-(4-Fluorophenyl)-N-[1-(2-phenylethyl)-4-piperidinyl]butanamide
ID: Reference4878
Other Names:
p-FBF ;
p-Fluorobutyrfentanyl ;
N-(4-Fluorophenyl)-N-(1-phenethylpiperidin-4-yl)butyramide;
p-Fluorobutyryl fentanyl
Formula: C23H29FN2O
Class: Drugs of Abuse/Illegal Drugs Sports Doping Drugs
4-Fluorobutyrfentanyl mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite; Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 3 |
| No. of Spectra | 1468 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | ESI; NSI |
| Analyzers | IT; FT |
| Last Modification | 12/5/2018 9:50:47 AM |
| InChI | InChI=1S/C23H29FN2O/c1-2-6-23(27)26(21-11-9-20(24)10-12-21)22-14-17-25(18-15-22)16-13-19-7-4-3-5-8-19/h3-5,7-12,22H,2,6,13-18H2,1H3 |
| InChI Key | QZFMCYUBPSLOBP-UHFFFAOYSA-N |
| Canonical SMILES | CCCC(=O)N(C1CCN(CC1)CCC2=CC=CC=C2)C3=CC=C(C=C3)F |
| CAS | |
| Splash | |
| Other Names |
p-FBF ; p-Fluorobutyrfentanyl ; N-(4-Fluorophenyl)-N-(1-phenethylpiperidin-4-yl)butyramide; p-Fluorobutyryl fentanyl |
| ChemSpider | 32779976 |
| PubChem | 86280430 |
| Wikipedia | 4-Fluorobutyrfentanyl |