Systematic / IUPAC Name: N-{1-[2-Hydroxy-2-(2-thienyl)ethyl]-4-piperidinyl}-N-phenylpropanamide
ID: Reference4879
Other Names:
N-{1-[2-Hydroxy-2-(thiophen-2-yl)ethyl]piperidin-4-yl}-N-phenylpropanamide;
Propanamide, N-{1-[2-hydroxy-2-(2-thienyl)ethyl]-4-piperidinyl}-N-phenyl-
Formula: C20H26N2O2S
Class: Drugs of Abuse/Illegal Drugs
β-Hydroxythiofentanyl mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite; Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 2358 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5, MS6 |
| Ionization Methods | ESI; NSI |
| Analyzers | IT; FT |
| Last Modification | 12/5/2018 9:47:28 AM |
| InChI | InChI=1S/C20H26N2O2S/c1-2-20(24)22(16-7-4-3-5-8-16)17-10-12-21(13-11-17)15-18(23)19-9-6-14-25-19/h3-9,14,17-18,23H,2,10-13,15H2,1H3 |
| InChI Key | GLAAETOTOUGGSB-UHFFFAOYSA-N |
| Canonical SMILES | CCC(=O)N(C1CCN(CC1)CC(C2=CC=CS2)O)C3=CC=CC=C3 |
| CAS | |
| Splash | |
| Other Names |
N-{1-[2-Hydroxy-2-(thiophen-2-yl)ethyl]piperidin-4-yl}-N-phenylpropanamide; Propanamide, N-{1-[2-hydroxy-2-(2-thienyl)ethyl]-4-piperidinyl}-N-phenyl- |
| PubChem | 117072582 |
| Wikipedia | Betahydroxythiofentanyl |
| ChemSpider | 21106268 |