Systematic / IUPAC Name: (1R,3S,5R,7S,12R)-12-Hydroxy-4,4,4',4',12,14-hexamethyl-9',10'-dihydro-4'H,13H-spiro[9,14-diazatetracyclo[5.5.2.01,9 03,7]tetradecane-5,8'-[1,4]dioxepino[2,3-g]indol]-13-one
ID: Reference4896
Other Names: Derquantelum
Formula: C28H37N3O4
Class: Excipients/Additives/Colorants
Derquantel mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 5/24/2016 9:34:12 AM |
| InChI | InChI=1S/C28H37N3O4/c1-23(2)10-12-34-21-18(35-23)8-7-17-20(21)29-15-26(17)14-27-16-31-11-9-25(5,33)28(31,22(32)30(27)6)13-19(27)24(26,3)4/h7-8,10,12,19,29,33H,9,11,13-16H2,1-6H3/t19-,25+,26-,27+,28-/m0/s1 |
| InChI Key | DYVLXWPZFQQUIU-WGNDVSEMSA-N |
| Canonical SMILES | CC1(C=COC2=C(O1)C=CC3=C2NCC34CC56CN7CCC(C7(CC5C4(C)C)C(=O)N6C)(C)O)C |
| CAS | |
| Splash | |
| Other Names | Derquantelum |
| KEGG | D09399 |
| ChEMBL | CHEMBL2103805 |
| PubChem | 25154194 |
| ChemSpider | 28529469 |