Systematic / IUPAC Name: 2-(4-chlorophenyl)-3-cyclopropyl-1-(1H-1,2,4-triazol-1-yl)butan-2-ol
ID: Reference49
Other Names:
1H-1,2,4-Triazole-1-ethanol, α-(4-chlorophenyl)-α-(1-cyclopropylethyl)-;
Atemi;
Sentinel turf fungicide;
Alto 100SL;
San 619F
Formula: C15H18ClN3O
Class: Pesticides/Herbicides
Cyproconazole mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | LTQ Orbitrap XL; Orbitrap ID-X with ETD_Cal Gateshead ; Q Exactive Orbitrap |
| No. of Spectral Trees | 7 |
| No. of Spectra | 1153 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | ESI; APCI; NSI |
| Analyzers | FT |
| Last Modification | 10/10/2016 11:16:23 AM |
| InChI | InChI=1S/C15H18ClN3O/c1-11(12-2-3-12)15(20,8-19-10-17-9-18-19)13-4-6-14(16)7-5-13/h4-7,9-12,20H,2-3,8H2,1H3 |
| InChI Key | UFNOUKDBUJZYDE-UHFFFAOYSA-N |
| Canonical SMILES | CC(C1CC1)C(CN2C=NC=N2)(C3=CC=C(C=C3)Cl)O |
| CAS | 94361065 |
| Splash | |
| Other Names |
1H-1,2,4-Triazole-1-ethanol, α-(4-chlorophenyl)-α-(1-cyclopropylethyl)-; Atemi; Sentinel turf fungicide; Alto 100SL; San 619F |
| PubChem | 86132 |
| KEGG | C18456 |
| ChEMBL | CHEMBL2131954 |
| ChemSpider | 77706 |
| Wikipedia | Cyproconazol (DE) |
| ChemIDPlus | 113096994; 094361065 |