Systematic / IUPAC Name: Methyl 2-benzamidoacetate
ID: Reference490
Other Names:
Hippuric acid, methyl ester;
Methyl (benzoylamino)acetate;
Hippurate methyl ester;
Glycine, N-benzoyl, methyl ester;
Methyl N-benzoylglycinate
; more
Formula: C10H11NO3
Class: Endogenous Metabolites
Methylhippuric acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite |
| No. of Spectral Trees | 2 |
| No. of Spectra | 245 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 10/11/2016 12:40:51 PM |
| InChI | InChI=1S/C10H11NO3/c1-14-9(12)7-11-10(13)8-5-3-2-4-6-8/h2-6H,7H2,1H3,(H,11,13) |
| InChI Key | XTKVNQKOTKPCKM-UHFFFAOYSA-N |
| Canonical SMILES | COC(=O)CNC(=O)C1=CC=CC=C1 |
| CAS | 1205089 |
| Splash | |
| Other Names |
Hippuric acid, methyl ester; Methyl (benzoylamino)acetate; Hippurate methyl ester; Glycine, N-benzoyl, methyl ester; Methyl N-benzoylglycinate; Hippuric acid methyl ester; N-Benzoylglycine methyl ester; Methyl 2-(phenylformamido)acetate; Benzoylglycine methyl ester; Methyl hippurate; Methyl benzoylglycinate; Methyl benzoylaminoacetate; Methyl 2-(benzoylamino)acetate; Methyl N-(phenylcarbonyl)glycinate; Methyl 2-(phenylcarbonylamino)acetate |
| PubChem | 14566 |
| HMDb | HMDB00859 |
| ChemSpider | 13907 |
| ChEBI | CHEBI:70869 |
| ChemIDPlus | 001205089 |
| ChEMBL | CHEMBL218718 |