Systematic / IUPAC Name: (1S,2R,3S,4S,6R,7R,8R,14R)-3-Hydroxy-2,4,7,14-tetramethyl-9-oxo-4-vinyltricyclo[5.4.3.01,8]tetradec-6-yl {[2-methyl-1-(D-valylamino)-2-propanyl]sulfanyl}acetate
ID: Reference4905
Other Names: Acetic acid, 2-[(2-{[(2R)-2-amino-3-methyl-1-oxobutyl]amino}-1,1-dimethylethyl)thio]-, (3aS,4R,5S,6S,8R,9R,9aR,10R)-6-ethenyldecahydro-5-hydroxy-4,6,9,10-tetramethyl-1-oxo-3a,9-propano-3aH-cyclopentacycloocten-8-yl ester
Formula: C31H52N2O5S
Class: Therapeutics/Prescription Drugs
Valnemulin mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 216 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 8/1/2016 11:35:23 AM |
| InChI | InChI=1S/C31H52N2O5S/c1-10-29(8)15-22(38-23(35)16-39-28(6,7)17-33-27(37)24(32)18(2)3)30(9)19(4)11-13-31(20(5)26(29)36)14-12-21(34)25(30)31/h10,18-20,22,24-26,36H,1,11-17,32H2,2-9H3,(H,33,37)/t19-,20+,22-,24-,25+,26+,29-,30+,31+/m1/s1 |
| InChI Key | LLYYNOVSVPBRGV-MVNKZKPCSA-N |
| Canonical SMILES | CC1CCC23CCC(=O)C2C1(C(CC(C(C3C)O)(C)C=C)OC(=O)CSC(C)(C)CNC(=O)C(C(C)C)N)C |
| CAS | |
| Splash | |
| Other Names | Acetic acid, 2-[(2-{[(2R)-2-amino-3-methyl-1-oxobutyl]amino}-1,1-dimethylethyl)thio]-, (3aS,4R,5S,6S,8R,9R,9aR,10R)-6-ethenyldecahydro-5-hydroxy-4,6,9,10-tetramethyl-1-oxo-3a,9-propano-3aH-cyclopentacycloocten-8-yl ester |
| ChEMBL | CHEMBL1688852 |
| ChemSpider | 8026591 |
| KEGG | C12066 |
| ChemIDPlus | 101312929 |
| PubChem | 9850878 |
| Wikipedia | Valnemulin |