Systematic / IUPAC Name: (2-Amino-1H-benzimidazol-5-yl)(4-fluorophenyl)methanone
ID: Reference4907
Other Names: Methanone, (2-amino-1H-benzimidazol-5-yl)(4-fluorophenyl)-
Formula: C14H10FN3O
Class: Therapeutics/Prescription Drugs
2-Aminoflubendazole mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 242 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 8/1/2016 10:46:06 AM |
| InChI | InChI=1S/C14H10FN3O/c15-10-4-1-8(2-5-10)13(19)9-3-6-11-12(7-9)18-14(16)17-11/h1-7H,(H3,16,17,18) |
| InChI Key | WINHLTQNRABBSW-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC(=CC=C1C(=O)C2=CC3=C(C=C2)N=C(N3)N)F |
| CAS | 82050133 |
| Splash | |
| Other Names | Methanone, (2-amino-1H-benzimidazol-5-yl)(4-fluorophenyl)- |