Systematic / IUPAC Name: 2-(2,5-Dimethoxyphenyl)-N-[(2-methoxyphenyl)methyl]ethanamine
ID: Reference4924
Other Names:
2C-H-NBOMe ;
2,5-Dimethoxy-N-[(2-methoxyphenyl)methyl]benzeneethanamine ;
Benzeneethanamine, 2,5-dimethoxy-N-[(2-methoxyphenyl)methyl]-
Formula: C18H23NO3
Class: Drugs of Abuse/Illegal Drugs Sports Doping Drugs
25H-NBOMe mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap; Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 3 |
| No. of Spectra | 357 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 1/30/2017 9:28:15 AM |
| InChI | InChI=1S/C18H23NO3/c1-20-16-8-9-18(22-3)14(12-16)10-11-19-13-15-6-4-5-7-17(15)21-2/h4-9,12,19H,10-11,13H2,1-3H3 |
| InChI Key | RMLXCDMTGWSEOU-UHFFFAOYSA-N |
| Canonical SMILES | COC1=CC(=C(C=C1)OC)CCNCC2=CC=CC=C2OC |
| CAS | |
| Splash | |
| Other Names |
2C-H-NBOMe ; 2,5-Dimethoxy-N-[(2-methoxyphenyl)methyl]benzeneethanamine ; Benzeneethanamine, 2,5-dimethoxy-N-[(2-methoxyphenyl)methyl]- |
| PubChem | 39424372 |