Systematic / IUPAC Name: 2-Amino-3-O-(1-carboxyethyl)-2-deoxyhexopyranose
ID: Reference495
Other Names:
2-(3-Amino-2,5-dihydroxy-6-hydroxymethyl-tetrahydro-pyran-4-yloxy)-propionic acid;
Muramic acid;
(+)-Muramic acid
Formula: C9H17NO7
Class: Endogenous Metabolites
Muramic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite |
| No. of Spectral Trees | 2 |
| No. of Spectra | 452 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 1/28/2015 1:45:39 PM |
| InChI | InChI=1S/C9H17NO7/c1-3(8(13)14)16-7-5(10)9(15)17-4(2-11)6(7)12/h3-7,9,11-12,15H,2,10H2,1H3,(H,13,14) |
| InChI Key | MSFSPUZXLOGKHJ-UHFFFAOYSA-N |
| Canonical SMILES | O=C(O)C(OC1C(O)C(OC(O)C1N)CO)C |
| CAS | 1114416 |
| Splash | |
| Other Names |
2-(3-Amino-2,5-dihydroxy-6-hydroxymethyl-tetrahydro-pyran-4-yloxy)-propionic acid; Muramic acid; (+)-Muramic acid |
| Wikipedia | Muramic acid |
| ChemIDPlus | 040525299 |
| PubChem | 433580 |
| ChemSpider | 383435 |