Systematic / IUPAC Name: (1-Butyl-7-hydroxy-1H-indol-3-yl)(1-naphthyl)methanone
ID: Reference4950
Other Names:
(1-Butyl-7-hydroxy-1H-indol-3-yl)(naphthalen-1-yl)-methanone;
Methanone, (1-butyl-7-hydroxy-1H-indol-3-yl)-1-naphthalenyl-
Formula: C23H21NO2
Class: Drugs of Abuse/Illegal Drugs Sports Doping Drugs
JWH 073 7-hydroxyindole metabolite mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 199 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 6/4/2016 11:21:24 AM |
| InChI | InChI=1S/C23H21NO2/c1-2-3-14-24-15-20(18-11-7-13-21(25)22(18)24)23(26)19-12-6-9-16-8-4-5-10-17(16)19/h4-13,15,25H,2-3,14H2,1H3 |
| InChI Key | RERSSQCTZKUWMM-UHFFFAOYSA-N |
| Canonical SMILES | CCCCN1C=C(C2=C1C(=CC=C2)O)C(=O)C3=CC=CC4=CC=CC=C43 |
| CAS | 1307803491 |
| Splash | |
| Other Names |
(1-Butyl-7-hydroxy-1H-indol-3-yl)(naphthalen-1-yl)-methanone; Methanone, (1-butyl-7-hydroxy-1H-indol-3-yl)-1-naphthalenyl- |
| ChemSpider | 26458427 |
| ChEMBL | CHEMBL2380417 |
| PubChem | 53394455 |