Systematic / IUPAC Name: 5-[3-(Adamantan-1-ylcarbamoyl)-1H-indazol-1-yl]pentanoic acid
ID: Reference4954
Other Names: 1H-Indazole-1-pentanoic acid, 3-[(tricyclo[3.3.1.13,7]dec-1-ylamino)carbonyl]-
Formula: C23H29N3O3
Class: Drugs of Abuse/Illegal Drugs Sports Doping Drugs
AKB48 N-pentanoic acid metabolite mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 108 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 6/4/2016 8:02:23 AM |
| InChI | InChI=1S/C23H29N3O3/c27-20(28)7-3-4-8-26-19-6-2-1-5-18(19)21(25-26)22(29)24-23-12-15-9-16(13-23)11-17(10-15)14-23/h1-2,5-6,15-17H,3-4,7-14H2,(H,24,29)(H,27,28) |
| InChI Key | CMCIJYXHEYJYQU-UHFFFAOYSA-N |
| Canonical SMILES | O=C(NC12C[C@H]3C[C@H](C[C@@H](C2)C3)C1)C4=NN(CCCCC(O)=O)C5=C4C=CC=C5 |
| CAS | 1630022944 |
| Splash | |
| Other Names | 1H-Indazole-1-pentanoic acid, 3-[(tricyclo[3.3.1.13,7]dec-1-ylamino)carbonyl]- |
| ChemSpider | 48058670 |