Systematic / IUPAC Name: 2-Acetamido-5-amino-5-oxopentanoic acid
ID: Reference496
Other Names:
(S)-2-Acetamido-5-amino-5-oxopentanoic acid;
N-Acetylglutamine;
N-α-Acetyl-L-glutamine;
Glutamine, N-acetyl-
Formula: C7H12N2O4
Class: Endogenous Metabolites
N-Acetyl-L-glutamine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite |
| No. of Spectral Trees | 2 |
| No. of Spectra | 256 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 1/28/2015 1:49:26 PM |
| InChI | InChI=1S/C7H12N2O4/c1-4(10)9-5(7(12)13)2-3-6(8)11/h5H,2-3H2,1H3,(H2,8,11)(H,9,10)(H,12,13)/t5-/m0/s1 |
| InChI Key | KSMRODHGGIIXDV-YFKPBYRVSA-N |
| Canonical SMILES | O=C(NC(C(=O)O)CCC(=O)N)C |
| CAS | 2490973 |
| Splash | |
| Other Names |
(S)-2-Acetamido-5-amino-5-oxopentanoic acid; N-Acetylglutamine; N-α-Acetyl-L-glutamine; Glutamine, N-acetyl- |
| KEGG | D07063 |
| ChEBI | CHEBI:21553 |
| PubChem | 182230 |
| ChemSpider | 158492 |
| Wikipedia | Aceglutamide |
| ChemIDPlus | 035305749 |