Systematic / IUPAC Name: (3Z)-N,N-Dimethyl-3-(thieno[2,3-c][2]benzothiepin-4(9H)-ylidene)-1-propanamine
ID: Reference4986
Other Names:
N,N-Dimethyl-3-thieno[2,3-c][2]benzothiepin-4(9H)-ylidenepropylamine ;
1-Propanamine, N,N-dimethyl-3-thieno[2,3-c][2]benzothiepin-4(9H)-ylidene, (3Z)-;
Dithiaden
Formula: C17H19NS2
Class: Therapeutics/Prescription Drugs
Bisulepine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos |
| No. of Spectral Trees | 1 |
| No. of Spectra | 603 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 6/6/2016 8:38:32 AM |
| InChI | InChI=1S/C17H19NS2/c1-18(2)10-5-8-15-14-7-4-3-6-13(14)12-20-17-16(15)9-11-19-17/h3-4,6-9,11H,5,10,12H2,1-2H3/b15-8- |
| InChI Key | ZLJLUTCIUOCIQM-NVNXTCNLSA-N |
| Canonical SMILES | CN(C)CCC=C1C2=C(SCC3=CC=CC=C31)SC=C2 |
| CAS | |
| Splash | |
| Other Names |
N,N-Dimethyl-3-thieno[2,3-c][2]benzothiepin-4(9H)-ylidenepropylamine ; 1-Propanamine, N,N-dimethyl-3-thieno[2,3-c][2]benzothiepin-4(9H)-ylidene, (3Z)-; Dithiaden |
| PubChem | 6537425 |
| ChemSpider | 5020597 |
| Wikipedia | Bisulepine |