Systematic / IUPAC Name: 4-{Ethyl[1-(4-methoxyphenyl)-2-propanyl]amino}butyl 3,4-dimethoxybenzoate
ID: Reference4988
Other Names:
4-{Ethyl[2-(4-methoxyphenyl)-1-methylethyl]amino}butyl 3,4-dimethoxybenzoate ;
4-(Ethyl{1-methyl-2-[4-(methyloxy)phenyl]ethyl}amino)butyl 3,4-bis(methyloxy)benzoate;
4-[Ethyl(p-methoxy-α-methylphenethyl)amino]butyl veratrate;
4-{Ethyl[1-(4-methoxyphenyl)propan-2-yl]amino}butyl 3,4-dimethoxybenzoate;
Benzoic acid, 3,4-dimethoxy, 4-{ethyl[2-(4-methoxyphenyl)-1-methylethyl]amino}butyl ester
Formula: C25H35NO5
Class: Therapeutics/Prescription Drugs Sports Doping Drugs
Mebeverine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1214 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 6/6/2016 10:12:25 AM |
| InChI | InChI=1S/C25H35NO5/c1-6-26(19(2)17-20-9-12-22(28-3)13-10-20)15-7-8-16-31-25(27)21-11-14-23(29-4)24(18-21)30-5/h9-14,18-19H,6-8,15-17H2,1-5H3 |
| InChI Key | VYVKHNNGDFVQGA-UHFFFAOYSA-N |
| Canonical SMILES | CCN(CCCCOC(=O)C1=CC(=C(C=C1)OC)OC)C(C)CC2=CC=C(C=C2)OC |
| CAS | |
| Splash | |
| Other Names |
4-{Ethyl[2-(4-methoxyphenyl)-1-methylethyl]amino}butyl 3,4-dimethoxybenzoate ; 4-(Ethyl{1-methyl-2-[4-(methyloxy)phenyl]ethyl}amino)butyl 3,4-bis(methyloxy)benzoate; 4-[Ethyl(p-methoxy-α-methylphenethyl)amino]butyl veratrate; 4-{Ethyl[1-(4-methoxyphenyl)propan-2-yl]amino}butyl 3,4-dimethoxybenzoate; Benzoic acid, 3,4-dimethoxy, 4-{ethyl[2-(4-methoxyphenyl)-1-methylethyl]amino}butyl ester ; Veratric acid, 4-[ethyl(p-methoxy-α-methylphenethyl)amino], butyl ester- |
| ChemIDPlus | 003625067 |
| KEGG | D08160 |
| Wikipedia | Mebeverine |
| ChemSpider | 3891 |
| PubChem | 4031 |