Systematic / IUPAC Name: 4-Amino-3-hydroxybenzoic acid
ID: Reference4992
Other Names:
2-Amino-5-carboxyphenol;
3-Hydroxy-4-aminobenzoic acid;
4-Amino-3-hydroxy benzoic acid;
4-Carboxy-2-hydroxyaniline;
Benzoic acid, 4-amino-3-hydroxy-
Formula: C7H7NO3
4-Amino-3-hydroxybenzoic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos |
| No. of Spectral Trees | 1 |
| No. of Spectra | 883 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 6/6/2016 11:26:44 AM |
| InChI | InChI=1S/C7H7NO3/c8-5-2-1-4(7(10)11)3-6(5)9/h1-3,9H,8H2,(H,10,11) |
| InChI Key | NFPYJDZQOKCYIE-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC(=C(C=C1C(=O)O)O)N |
| CAS | 2374030 |
| Splash | |
| Other Names |
2-Amino-5-carboxyphenol; 3-Hydroxy-4-aminobenzoic acid; 4-Amino-3-hydroxy benzoic acid; 4-Carboxy-2-hydroxyaniline; Benzoic acid, 4-amino-3-hydroxy- |
| ChemIDPlus | 002374030 |
| PubChem | 137566 |
| ChEMBL | CHEMBL1462 |
| ChemSpider | 121227 |