Systematic / IUPAC Name: 4-[2-(Dipropylamino)ethyl]-1,3-dihydro-2H-indol-2-one
ID: Reference4998
Other Names:
Requip CR;
Requip XL;
Ronirol;
Ropinirol;
2H-Indol-2-one, 4-[2-(dipropylamino)ethyl]-1,3-dihydro-
; more
Formula: C16H24N2O
Class: Therapeutics/Prescription Drugs
Ropinirole mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos |
| No. of Spectral Trees | 1 |
| No. of Spectra | 541 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 6/6/2016 12:43:34 PM |
| InChI | InChI=1S/C16H24N2O/c1-3-9-18(10-4-2)11-8-13-6-5-7-15-14(13)12-16(19)17-15/h5-7H,3-4,8-12H2,1-2H3,(H,17,19) |
| InChI Key | UHSKFQJFRQCDBE-UHFFFAOYSA-N |
| Canonical SMILES | CCCN(CCC)CCC1=C2CC(=O)NC2=CC=C1 |
| CAS | 91374219 |
| Splash | |
| Other Names |
Requip CR; Requip XL; Ronirol; Ropinirol; 2H-Indol-2-one, 4-[2-(dipropylamino)ethyl]-1,3-dihydro-; 4-[2-(Dipropylamino)ethyl]indolin-2-one ; 4-(2-Dipropylaminoethyl)-1,3-dihydroindol-2-one; 4-[2-(Dipropylamino)ethyl]-1,3-dihydroindol-2-one; 4-[2-(Dipropylamino)ethyl]-2,3-dihydro-1H-indol-2-one; 4-[2-(Dipropylamino)ethyl]2-indolinone; 4-[2-(Dipropylamino)ethyl]-3H-indol-2-ol; 4-[2-(Dipropylamino)ethyl]indolin-2-one |
| ChemIDPlus | 091374219 |
| ChEBI | CHEBI:8888 |
| PubChem | 5095 |
| KEGG | C07564; D08489 |
| DrugBank | DB00268 |
| HMDb | HMDB14413 |
| Wikipedia | Ropinirole |
| ChemSpider | 4916 |