Systematic / IUPAC Name: 3'-Carbamoyl-3-biphenylyl cyclohexylcarbamate
ID: Reference5002
Other Names:
BR-40097;
FAAH Inhibitor II;
KDS-4103;
[3'-(Aminocarbonyl)(1,1'-biphenyl)-3-yl]-cyclohexylcarbamate ;
[3-(3-Carbamoylphenyl)phenyl] N-cyclohexylcarbamate
; more
Formula: C20H22N2O3
Class: Drugs of Abuse/Illegal Drugs Sports Doping Drugs
URB597 mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 6/29/2016 5:45:52 AM |
| InChI | InChI=1S/C20H22N2O3/c21-19(23)16-8-4-6-14(12-16)15-7-5-11-18(13-15)25-20(24)22-17-9-2-1-3-10-17/h4-8,11-13,17H,1-3,9-10H2,(H2,21,23)(H,22,24) |
| InChI Key | ROFVXGGUISEHAM-UHFFFAOYSA-N |
| Canonical SMILES | C1CCC(CC1)NC(=O)OC2=CC=CC(=C2)C3=CC(=CC=C3)C(=O)N |
| CAS | 546141086 |
| Splash | |
| Other Names |
BR-40097; FAAH Inhibitor II; KDS-4103; [3'-(Aminocarbonyl)(1,1'-biphenyl)-3-yl]-cyclohexylcarbamate ; [3-(3-Carbamoylphenyl)phenyl] N-cyclohexylcarbamate; N-Cyclohexylcarbamic acid [3-(3-carbamoylphenyl)phenyl] ester; N-Cyclohexylcarbamic acid 3'-(aminocarbonyl)(1,1'-biphenyl)-3-yl ester ; 3-(3-Carbamoylphenyl)phenyl N-cyclohexylcarbamate; 3'-(Aminocarbonyl)-(1,1'-biphenyl)-3-yl cyclohexylcarbamate ; 3-[3-(N-Cyclohexylcarbamoyloxy)phenyl]benzamide; 3'-Carbamoyl-(1,1'-biphenyl)-3-yl cyclohexylcarbamate ; 3'-Carbamoylbiphenyl-3-yl cyclohexylcarbamate; Carbamic acid, N-cyclohexyl, 3'-(aminocarbonyl)(1,1'-biphenyl)-3-yl ester ; Cyclohexyl carbamic acid 3'-carbamoylbiphenyl-3-yl ester |
| ChEMBL | CHEMBL184238 |
| PubChem | 1383884 |
| Wikipedia | URB597 |
| ChemIDPlus | 546141086 |
| ChemSpider | 1156960 |