Systematic / IUPAC Name: [3-(3-Carbamoylphenyl)-4-hydroxyphenyl] N-cyclohexylcarbamate
ID: Reference5004
Other Names:
3'-Carbamoyl-6-hydroxybiphenyl-3-yl cyclohexylcarbamate;
Carbamic acid, N-cyclohexyl, 3'-(aminocarbonyl)-6-hydroxy[1,1'-biphenyl]-3-yl ester
Formula: C20H22N2O4
Class: Sports Doping Drugs Drugs of Abuse/Illegal Drugs
URB937 mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 203 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 6/14/2016 1:31:29 PM |
| InChI | InChI=1S/C20H22N2O4/c21-19(24)14-6-4-5-13(11-14)17-12-16(9-10-18(17)23)26-20(25)22-15-7-2-1-3-8-15/h4-6,9-12,15,23H,1-3,7-8H2,(H2,21,24)(H,22,25) |
| InChI Key | CMEQHOXCIGFZNJ-UHFFFAOYSA-N |
| Canonical SMILES | C1CCC(CC1)NC(=O)OC2=CC(=C(C=C2)O)C3=CC(=CC=C3)C(=O)N |
| CAS | 1357160725 |
| Splash | |
| Other Names |
3'-Carbamoyl-6-hydroxybiphenyl-3-yl cyclohexylcarbamate; Carbamic acid, N-cyclohexyl, 3'-(aminocarbonyl)-6-hydroxy[1,1'-biphenyl]-3-yl ester |
| ChemSpider | 26458662 |
| PubChem | 53394762 |
| ChEMBL | CHEMBL2402927 |