Systematic / IUPAC Name: 2-[(1-Methyl-1H-imidazol-2-yl)sulfanyl]-N-[4-(2-methyl-2-propanyl)phenyl]acetamide
ID: Reference5010
Other Names: Acetamide, N-[4-(1,1-dimethylethyl)phenyl]-2-[(1-methyl-1H-imidazol-2-yl)thio]-
Formula: C16H21N3OS
N1-[4-(tert-Butyl)phenyl]-2-[(1-methyl-1H-imidazol-2-yl)thio]acetamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 6/20/2016 9:07:22 AM |
| InChI | InChI=1S/C16H21N3OS/c1-16(2,3)12-5-7-13(8-6-12)18-14(20)11-21-15-17-9-10-19(15)4/h5-10H,11H2,1-4H3,(H,18,20) |
| InChI Key | HKYVUDJGAHDBLQ-UHFFFAOYSA-N |
| Canonical SMILES | CC(C)(C)C1=CC=C(C=C1)NC(=O)CSC2=NC=CN2C |
| CAS | |
| Splash | |
| Other Names | Acetamide, N-[4-(1,1-dimethylethyl)phenyl]-2-[(1-methyl-1H-imidazol-2-yl)thio]- |