Systematic / IUPAC Name: 4-(4-Fluorophenyl)-5-[hydroxy(diphenyl)methyl]-2,4-dihydro-3H-1,2,4-triazole-3-thione
ID: Reference5011
Other Names: 3H-1,2,4-Triazole-3-thione, 4-(4-fluorophenyl)-2,4-dihydro-5-(hydroxydiphenylmethyl)-
Formula: C21H16FN3OS
[4-(4-Fluorophenyl)-5-mercapto-4H-1,2,4-triazol-3-yl](diphenyl)methanol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 6/20/2016 9:29:07 AM |
| InChI | InChI=1S/C21H16FN3OS/c22-17-11-13-18(14-12-17)25-19(23-24-20(25)27)21(26,15-7-3-1-4-8-15)16-9-5-2-6-10-16/h1-14,26H,(H,24,27) |
| InChI Key | NKHVLKTZMSQVQL-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=NNC(=S)N3C4=CC=C(C=C4)F)O |
| CAS | |
| Splash | |
| Other Names | 3H-1,2,4-Triazole-3-thione, 4-(4-fluorophenyl)-2,4-dihydro-5-(hydroxydiphenylmethyl)- |