Systematic / IUPAC Name: 6-Methyl-2-nitro-3-[(3-nitro-2-pyridinyl)oxy]pyridine
ID: Reference5025
Other Names: Pyridine, 6-methyl-2-nitro-3-[(3-nitro-2-pyridinyl)oxy]-
Formula: C11H8N4O5
6-Methyl-2-nitro-3-[(3-nitro-2-pyridyl)oxy]pyridine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 6/21/2016 1:42:59 PM |
| InChI | InChI=1S/C11H8N4O5/c1-7-4-5-9(10(13-7)15(18)19)20-11-8(14(16)17)3-2-6-12-11/h2-6H,1H3 |
| InChI Key | SLSHHMOXJLIUJL-UHFFFAOYSA-N |
| Canonical SMILES | |
| CAS | |
| Splash | |
| Other Names | Pyridine, 6-methyl-2-nitro-3-[(3-nitro-2-pyridinyl)oxy]- |