Systematic / IUPAC Name: 4-Amino-5-[3-(3,4-dichlorophenyl)-1H-pyrazol-5-yl]-2,6-dimethyl-3(2H)-pyridazinone
ID: Reference5026
Other Names: 3(2H)-Pyridazinone, 4-amino-5-[3-(3,4-dichlorophenyl)-1H-pyrazol-5-yl]-2,6-dimethyl-
Formula: C15H13Cl2N5O
4-Amino-5-[5-(3,4-dichlorophenyl)-1H-pyrazol-3-yl]-2,6-dimethyl-2,3-dihydropyridazin-3-one mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 211 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 6/21/2016 2:21:17 PM |
| InChI | InChI=1S/C15H13Cl2N5O/c1-7-13(14(18)15(23)22(2)21-7)12-6-11(19-20-12)8-3-4-9(16)10(17)5-8/h3-6H,18H2,1-2H3,(H,19,20) |
| InChI Key | LLHOWJNGWYUAFI-UHFFFAOYSA-N |
| Canonical SMILES | CC1=NN(C(=O)C(=C1C2=CC(=NN2)C3=CC(=C(C=C3)Cl)Cl)N)C |
| CAS | |
| Splash | |
| Other Names | 3(2H)-Pyridazinone, 4-amino-5-[3-(3,4-dichlorophenyl)-1H-pyrazol-5-yl]-2,6-dimethyl- |
| ChEMBL | CHEMBL1300550 |
| ChemSpider | 2079913 |
| PubChem | 2801200 |