Systematic / IUPAC Name: 2,2-Dichloro-N-(2,6-dibromo-4-methylphenyl)acetamide
ID: Reference5039
Other Names: Acetamide, 2,2-dichloro-N-(2,6-dibromo-4-methylphenyl)-
Formula: C9H7Br2Cl2NO
N1-(2,6-Dibromo-4-methylphenyl)-2,2-dichloroacetamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 6/24/2016 7:58:40 AM |
| InChI | InChI=1S/C9H7Br2Cl2NO/c1-4-2-5(10)7(6(11)3-4)14-9(15)8(12)13/h2-3,8H,1H3,(H,14,15) |
| InChI Key | XXBFESZHEOOEQG-UHFFFAOYSA-N |
| Canonical SMILES | CC1=CC(=C(C(=C1)Br)NC(=O)C(Cl)Cl)Br |
| CAS | |
| Splash | |
| Other Names | Acetamide, 2,2-dichloro-N-(2,6-dibromo-4-methylphenyl)- |