Systematic / IUPAC Name: 2-Acetylphenyl 5-nitro-2-furoate
ID: Reference5041
Other Names: 2-Furancarboxylic acid, 5-nitro-, 2-acetylphenyl ester
Formula: C13H9NO6
2-Acetylphenyl 5-nitro-2-furoate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 105 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 6/24/2016 8:39:20 AM |
| InChI | InChI=1S/C13H9NO6/c1-8(15)9-4-2-3-5-10(9)20-13(16)11-6-7-12(19-11)14(17)18/h2-7H,1H3 |
| InChI Key | ZUIIWQIOCSLXPR-UHFFFAOYSA-N |
| Canonical SMILES | |
| CAS | |
| Splash | |
| Other Names | 2-Furancarboxylic acid, 5-nitro-, 2-acetylphenyl ester |
| ChemSpider | 2083739 |
| ChEMBL | CHEMBL1330264 |
| PubChem | 2805208 |