Systematic / IUPAC Name: N,N'-Bis(2-furylmethyl)-5-nitro-4,6-pyrimidinediamine
ID: Reference5043
Other Names:
N,N'-Bis(2-furylmethyl)-5-nitropyrimidine-4,6-diamine ;
4,6-Pyrimidinediamine, N4,N6-bis(2-furanylmethyl)-5-nitro-
Formula: C14H13N5O4
N4,N6-Bis(2-furylmethyl)-5-nitropyrimidine-4,6-diamine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 6/24/2016 1:13:25 PM |
| InChI | InChI=1S/C14H13N5O4/c20-19(21)12-13(15-7-10-3-1-5-22-10)17-9-18-14(12)16-8-11-4-2-6-23-11/h1-6,9H,7-8H2,(H2,15,16,17,18) |
| InChI Key | YAKCXRCZVYGCIP-UHFFFAOYSA-N |
| Canonical SMILES | |
| CAS | |
| Splash | |
| Other Names |
N,N'-Bis(2-furylmethyl)-5-nitropyrimidine-4,6-diamine ; 4,6-Pyrimidinediamine, N4,N6-bis(2-furanylmethyl)-5-nitro- |
| ChemSpider | 222793 |
| ChEMBL | CHEMBL1734559 |
| PubChem | 254185 |