Systematic / IUPAC Name: 2-{[(4-Chlorophenyl)sulfanyl]methyl}quinuclidin-3-one
ID: Reference5045
Other Names: 1-Azabicyclo[2.2.2]octan-3-one, 2-{[(4-chlorophenyl)thio]methyl}-
Formula: C14H16ClNOS
2-{[(4-Chlorophenyl)thio]methyl}quinuclidin-3-one mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 6/27/2016 8:31:30 AM |
| InChI | InChI=1S/C14H16ClNOS/c15-11-1-3-12(4-2-11)18-9-13-14(17)10-5-7-16(13)8-6-10/h1-4,10,13H,5-9H2 |
| InChI Key | YZFHRTZIHJCXEI-UHFFFAOYSA-N |
| Canonical SMILES | C1CN2CCC1C(=O)C2CSC3=CC=C(C=C3)Cl |
| CAS | |
| Splash | |
| Other Names | 1-Azabicyclo[2.2.2]octan-3-one, 2-{[(4-chlorophenyl)thio]methyl}- |
| ChemSpider | 2100314 |
| ChEMBL | CHEMBL2316612 |
| PubChem | 2822094 |