Systematic / IUPAC Name: 2-[(2-Acetamido-3-carboxypropanoyl)amino]pentanedioic acid
ID: Reference505
Other Names:
2-(3-Carboxy-2-acetamidopropanamido)pentanedioic acid;
N-Acetyl-Asp-Glu;
Spaglumic acid;
N-Acetylaspartylglutamic acid;
N-(N-Acetylaspartyl)glutamic acid
Formula: C11H16N2O8
Class: Endogenous Metabolites
N-Acetyl-1-aspartylglutamic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite |
| No. of Spectral Trees | 2 |
| No. of Spectra | 444 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 1/29/2015 9:06:38 AM |
| InChI | InChI=1S/C11H16N2O8/c1-5(14)12-7(4-9(17)18)10(19)13-6(11(20)21)2-3-8(15)16/h6-7H,2-4H2,1H3,(H,12,14)(H,13,19)(H,15,16)(H,17,18)(H,20,21) |
| InChI Key | OPVPGKGADVGKTG-UHFFFAOYSA-N |
| Canonical SMILES | CC(=O)NC(CC(=O)O)C(=O)NC(CCC(=O)O)C(=O)O |
| CAS | 3106852 |
| Splash | |
| Other Names |
2-(3-Carboxy-2-acetamidopropanamido)pentanedioic acid; N-Acetyl-Asp-Glu; Spaglumic acid; N-Acetylaspartylglutamic acid; N-(N-Acetylaspartyl)glutamic acid; N-Acetyl-α-aspartylglutamic acid |
| PubChem | 5255 |
| ChemSpider | 5065; 21238199 |
| ChEMBL | CHEMBL64966 |
| KEGG | C12270 |
| HMDb | HMDB01067 |
| Wikipedia | N-Acetylaspartylglutamic acid |