Systematic / IUPAC Name: [5-(2-Fluorophenyl)-1-pentyl-1H-pyrrol-3-yl](1-naphthyl)methanone
ID: Reference5053
Other Names:
JWH 307;
[5-(2-Fluorophenyl)-1-pentyl-1H-pyrrol-3-yl](naphthalen-1-yl)methanone ;
Methanone, [5-(2-fluorophenyl)-1-pentyl-1H-pyrrol-3-yl]-1-naphthalenyl-;
[5-(2-fluorophenyl)-1-pentyl-1H-pyrrol-3-yl]-1-naphthalenyl-methanone
Formula: C26H24FNO
Class: Drugs of Abuse/Illegal Drugs Sports Doping Drugs
JWH-307 mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 111 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 6/29/2016 11:39:49 AM |
| InChI | InChI=1S/C26H24FNO/c1-2-3-8-16-28-18-20(17-25(28)23-13-6-7-15-24(23)27)26(29)22-14-9-11-19-10-4-5-12-21(19)22/h4-7,9-15,17-18H,2-3,8,16H2,1H3 |
| InChI Key | WYNZPDDTQGVCLZ-UHFFFAOYSA-N |
| Canonical SMILES | CCCCCN1C=C(C=C1C2=CC=CC=C2F)C(=O)C3=CC=CC4=CC=CC=C43 |
| CAS | 914458267 |
| Splash | |
| Other Names |
JWH 307; [5-(2-Fluorophenyl)-1-pentyl-1H-pyrrol-3-yl](naphthalen-1-yl)methanone ; Methanone, [5-(2-fluorophenyl)-1-pentyl-1H-pyrrol-3-yl]-1-naphthalenyl-; [5-(2-fluorophenyl)-1-pentyl-1H-pyrrol-3-yl]-1-naphthalenyl-methanone |
| Wikipedia | JWH-307 |
| PubChem | 16049783 |
| ChemSpider | 13178178 |
| ChEMBL | CHEMBL216857 |