Systematic / IUPAC Name: 2-(Methylamino)-1-(4-methylphenyl)-1-butanone
ID: Reference5072
Other Names:
BZ-6378 ;
1-Butanone, 2-(methylamino)-1-(4-methylphenyl)-;
4-methyl BP ;
4-Methyl-N-methylbutiophenone
Formula: C12H17NO
Class: Drugs of Abuse/Illegal Drugs Sports Doping Drugs
4-Methylbuphedrone mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 7/1/2016 7:37:05 AM |
| InChI | InChI=1S/C12H17NO/c1-4-11(13-3)12(14)10-7-5-9(2)6-8-10/h5-8,11,13H,4H2,1-3H3 |
| InChI Key | ZOGGCQVVLHCLHY-UHFFFAOYSA-N |
| Canonical SMILES | CCC(C(=O)C1=CC=C(C=C1)C)NC |
| CAS | |
| Splash | |
| Other Names |
BZ-6378 ; 1-Butanone, 2-(methylamino)-1-(4-methylphenyl)-; 4-methyl BP ; 4-Methyl-N-methylbutiophenone |
| PubChem | 71750237 |
| ChemSpider | 26702147 |
| Wikipedia | 4-Methylbuphedrone |