Systematic / IUPAC Name: N-Acetylserine
ID: Reference508
Other Names:
N-Acetylserine;
DL-Serine, N-acetyl-;
Serine, N-acetyl-;
2-(Acetylamino)-3-hydroxypropanoic acid;
2-(Acetylamino)-3-hydroxypropionic acid
; more
Formula: C5H9NO4
Class: Endogenous Metabolites
N-Acetyl-DL-serine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite |
| No. of Spectral Trees | 2 |
| No. of Spectra | 194 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 10/11/2016 1:03:58 PM |
| InChI | InChI=1S/C5H9NO4/c1-3(8)6-4(2-7)5(9)10/h4,7H,2H2,1H3,(H,6,8)(H,9,10) |
| InChI Key | JJIHLJJYMXLCOY-UHFFFAOYSA-N |
| Canonical SMILES | CC(=O)NC(CO)C(=O)O |
| CAS | 97143 |
| Splash | |
| Other Names |
N-Acetylserine; DL-Serine, N-acetyl-; Serine, N-acetyl-; 2-(Acetylamino)-3-hydroxypropanoic acid; 2-(Acetylamino)-3-hydroxypropionic acid; 2-Acetamido-3-hydroxypropanoic acid; 2-Acetylamino-3-hydroxy-propionic acid |