Systematic / IUPAC Name: (E)-N-[2-(2,5-Dimethoxyphenyl)ethyl]-1-(2-methoxyphenyl)methanimine
ID: Reference5084
Other Names:
(E)-2-(2,5-Dimethoxyphenyl)-N-(2-methoxybenzylidene)ethanamine ;
Benzeneethanamine, 2,5-dimethoxy-N-[(1E)-(2-methoxyphenyl)methylene]-
Formula: C18H21NO3
Class: Drugs of Abuse/Illegal Drugs
25H-NBOMe imine analog mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 11/9/2016 11:43:17 AM |
| InChI | InChI=1S/C18H21NO3/c1-20-16-8-9-18(22-3)14(12-16)10-11-19-13-15-6-4-5-7-17(15)21-2/h4-9,12-13H,10-11H2,1-3H3/b19-13+ |
| InChI Key | QPVMUPLRZMIWJW-CPNJWEJPSA-N |
| Canonical SMILES | COC1=C(CC/N=C/C2=C(OC)C=CC=C2)C=C(OC)C=C1 |
| CAS | 1566571785 |
| Splash | |
| Other Names |
(E)-2-(2,5-Dimethoxyphenyl)-N-(2-methoxybenzylidene)ethanamine ; Benzeneethanamine, 2,5-dimethoxy-N-[(1E)-(2-methoxyphenyl)methylene]- |