Systematic / IUPAC Name: (2R,2'R,4a'S,5S,5'R,6'S,8a'S)-5-(2-Hydroxyethyl)-5,5'-bis(hydroxymethyl)-2',5',8a'-trimethyldecahydro-2'H,3H-spiro[furan-2,1'-naphthalen]-6'-ol
ID: Reference5087
Other Names:
Lagochiline;
(1R,2S,4aS,5R,5'S,6R,8aS)-5'-(2-Hydroxyethyl)-1,5'-bis(hydroxymethyl)-1,4a,6-trimethylspiro[3,4,6,7,8,8a-hexahydro-2H-naphthalene-5,2'-oxolane]-2-ol;
Spiro[furan-2(3H),1'(2'H)-naphthalene]-5,5'-dimethanol, decahydro-6'-hydroxy-5-(2-hydroxyethyl)-2',5',8'a-trimethyl-, (2R,2'R,4'aS,5S,5'R,6'S,8'aS)-
Formula: C20H36O5
Class: Drugs of Abuse/Illegal Drugs Endogenous Metabolites
Lagochilin mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 7/7/2016 8:59:02 AM |
| InChI | InChI=1S/C20H36O5/c1-14-4-5-15-17(2,12-22)16(24)6-7-18(15,3)20(14)9-8-19(13-23,25-20)10-11-21/h14-16,21-24H,4-13H2,1-3H3/t14-,15+,16+,17+,18+,19+,20-/m1/s1 |
| InChI Key | XYPPDQHBNJURHU-IPOQXWOTSA-N |
| Canonical SMILES | CC1CCC2C(C13CCC(O3)(CCO)CO)(CCC(C2(C)CO)O)C |
| CAS | 23554816 |
| Splash | |
| Other Names |
Lagochiline; (1R,2S,4aS,5R,5'S,6R,8aS)-5'-(2-Hydroxyethyl)-1,5'-bis(hydroxymethyl)-1,4a,6-trimethylspiro[3,4,6,7,8,8a-hexahydro-2H-naphthalene-5,2'-oxolane]-2-ol; Spiro[furan-2(3H),1'(2'H)-naphthalene]-5,5'-dimethanol, decahydro-6'-hydroxy-5-(2-hydroxyethyl)-2',5',8'a-trimethyl-, (2R,2'R,4'aS,5S,5'R,6'S,8'aS)- |
| Wikipedia | Lagochilin |
| ChEMBL | CHEMBL2165226 |
| ChemSpider | 5417062 |
| PubChem | 7061097 |