Systematic / IUPAC Name: 4-(2-Aminopropyl)-2-methoxyphenol
ID: Reference5092
Other Names:
3-O-Methyl-α-methyldopamine;
4-Hydroxy-3-methoxyamphetamine ;
Phenol, 4-(2-aminopropyl)-2-methoxy-;
HMA ;
NSC 172191
Formula: C10H15NO2
Class: Drugs of Abuse/Illegal Drugs Sports Doping Drugs Endogenous Metabolites Therapeutics/Prescription Drugs
4-(2-Aminopropyl)-2-methoxyphenol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 7/7/2016 1:47:08 PM |
| InChI | InChI=1S/C10H15NO2/c1-7(11)5-8-3-4-9(12)10(6-8)13-2/h3-4,6-7,12H,5,11H2,1-2H3 |
| InChI Key | GPBOYXOSSQEJBH-UHFFFAOYSA-N |
| Canonical SMILES | CC(CC1=CC(=C(C=C1)O)OC)N |
| CAS | |
| Splash | |
| Other Names |
3-O-Methyl-α-methyldopamine; 4-Hydroxy-3-methoxyamphetamine ; Phenol, 4-(2-aminopropyl)-2-methoxy-; HMA ; NSC 172191 |
| ChemSpider | 170725 |
| ChEMBL | CHEMBL1347 |
| PubChem | 197139 |
| HMDb | HMDB60748 |
| ChemIDPlus | 013026443 |