Systematic / IUPAC Name: 2-(3-Acetamidopropanoylamino)-3-(1H-imidazol-5-yl)propanoic acid
ID: Reference510
Other Names:
N-Acetyl carnosine;
Histidine, N-acetyl-β-alanyl-;
N-Acetyl-β-alanylhistidine;
N-α-Acetyl-L-carnosine
Formula: C11H16N4O4
Class: Endogenous Metabolites
N-Acetyl-L-carnosine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite; Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 3 |
| No. of Spectra | 1852 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | ESI; NSI |
| Analyzers | FT |
| Last Modification | 1/29/2015 1:06:29 PM |
| InChI | InChI=1S/C11H16N4O4/c1-7(16)13-3-2-10(17)15-9(11(18)19)4-8-5-12-6-14-8/h5-6,9H,2-4H2,1H3,(H,12,14)(H,13,16)(H,15,17)(H,18,19) |
| InChI Key | BKAYIFDRRZZKNF-UHFFFAOYSA-N |
| Canonical SMILES | O=C(NCCC(=O)NC(C(=O)O)Cc1cncn1)C |
| CAS | 56353152 |
| Splash | |
| Other Names |
N-Acetyl carnosine; Histidine, N-acetyl-β-alanyl-; N-Acetyl-β-alanylhistidine; N-α-Acetyl-L-carnosine |
| Wikipedia | Acetylcarnosine |
| ChemSpider | 82910 |
| PubChem | 91814 |
| ChemIDPlus | 056353152 |