Systematic / IUPAC Name: 8-Bromo-6-(2-fluorophenyl)-1-methyl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine
ID: Reference5116
Other Names: 4H-[1,2,4]Triazolo[4,3-a][1,4]benzodiazepine, 8-bromo-6-(2-fluorophenyl)-1-methyl-
Formula: C17H12BrFN4
Class: Drugs of Abuse/Illegal Drugs
Flubromazolam mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 118 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 7/11/2016 11:40:24 AM |
| InChI | InChI=1S/C17H12BrFN4/c1-10-21-22-16-9-20-17(12-4-2-3-5-14(12)19)13-8-11(18)6-7-15(13)23(10)16/h2-8H,9H2,1H3 |
| InChI Key | VXGSZBZQCBNUIP-UHFFFAOYSA-N |
| Canonical SMILES | CC1=NN=C2N1C3=C(C=C(C=C3)Br)C(=NC2)C4=CC=CC=C4F |
| CAS | 612526406 |
| Splash | |
| Other Names | 4H-[1,2,4]Triazolo[4,3-a][1,4]benzodiazepine, 8-bromo-6-(2-fluorophenyl)-1-methyl- |
| ChemSpider | 10684757 |
| PubChem | 21930924 |
| Wikipedia | Flubromazolam |