Systematic / IUPAC Name: N-Acetylleucine
ID: Reference512
Other Names:
(S)-2-Acetamido-4-methylpentanoic acid;
(2S)-2-(Acetylamino)-4-methylpentanoic acid;
N-Acetylleucine;
Acetyl-L-leucine;
Leucine, N-acetyl, L-
Formula: C8H15NO3
Class: Therapeutics/Prescription Drugs
N-Acetyl-L-leucine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite |
| No. of Spectral Trees | 2 |
| No. of Spectra | 216 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 1/29/2015 2:34:55 PM |
| InChI | InChI=1S/C8H15NO3/c1-5(2)4-7(8(11)12)9-6(3)10/h5,7H,4H2,1-3H3,(H,9,10)(H,11,12)/t7-/m0/s1 |
| InChI Key | WXNXCEHXYPACJF-ZETCQYMHSA-N |
| Canonical SMILES | CC(C)CC(C(=O)O)NC(=O)C |
| CAS | 1188212 |
| Splash | |
| Other Names |
(S)-2-Acetamido-4-methylpentanoic acid; (2S)-2-(Acetylamino)-4-methylpentanoic acid; N-Acetylleucine; Acetyl-L-leucine; Leucine, N-acetyl, L- |
| ChEMBL | CHEMBL56021 |
| HMDb | HMDB11756 |
| ChemIDPlus | 001188212 |
| ChemSpider | 1918 |
| KEGG | C02710 |
| PubChem | 70912 |
| ChEBI | CHEBI:17786 |
| Wikipedia | Acetylleucine |